C21H31NO3 — CID 74430125
4-benzyl-3-(2-methyldecanoyl)-1,3-oxazolidin-2-one (PubChem CID 74430125) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is 4-benzyl-3-(2-methyldecanoyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-(2-methyldecanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 74430125 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 4-benzyl-3-(2-methyldecanoyl)-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCC(C)C(=O)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C21H31NO3/c1-3-4-5-6-7-9-12-17(2)20(23)22-19(16-25-21(22)24)15-18-13-10-8-11-14-18/h8,10-11,13-14,17,19H,3-7,9,12,15-16H2,1-2H3 |
| InChIKey | MEHUGOLOYIYPQM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|