C23H35NO3 — CID 177137787
(4R)-4-benzyl-3-(3-pentyloctanoyl)-1,3-oxazolidin-2-one (PubChem CID 177137787) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is (4R)-4-benzyl-3-(3-pentyloctanoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-(3-pentyloctanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 177137787 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | (4R)-4-benzyl-3-(3-pentyloctanoyl)-1,3-oxazolidin-2-one |
| SMILES | CCCCCC(CCCCC)CC(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H35NO3/c1-3-5-8-12-20(13-9-6-4-2)17-22(25)24-21(18-27-23(24)26)16-19-14-10-7-11-15-19/h7,10-11,14-15,20-21H,3-6,8-9,12-13,16-18H2,1-2H3/t21-/m1/s1 |
| InChIKey | ZESQWCLQUWFBPK-OAQYLSRUSA-N |
| XLogP | 5.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|