C18H25NO5 — CID 102039216
(4S)-3-[(3R)-3-hydroxyoctanoyl]-4-[(4-hydroxyphenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 102039216) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is (4S)-3-[(3R)-3-hydroxyoctanoyl]-4-[(4-hydroxyphenyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(3R)-3-hydroxyoctanoyl]-4-[(4-hydroxyphenyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102039216 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (4S)-3-[(3R)-3-hydroxyoctanoyl]-4-[(4-hydroxyphenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCC[C@@H](O)CC(=O)N1C(=O)OC[C@@H]1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C18H25NO5/c1-2-3-4-5-16(21)11-17(22)19-14(12-24-18(19)23)10-13-6-8-15(20)9-7-13/h6-9,14,16,20-21H,2-5,10-12H2,1H3/t14-,16+/m0/s1 |
| InChIKey | SZAQFBXFCSFXAD-GOEBONIOSA-N |
| XLogP | 2.61 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|