C21H31NO4 — CID 129245127
4-benzyl-3-[(2S,3S)-3-hydroxy-2-methyldecanoyl]-1,3-oxazolidin-2-one (PubChem CID 129245127) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is 4-benzyl-3-[(2S,3S)-3-hydroxy-2-methyldecanoyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-benzyl-3-[(2S,3S)-3-hydroxy-2-methyldecanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 129245127 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 4-benzyl-3-[(2S,3S)-3-hydroxy-2-methyldecanoyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCCC[C@H](O)[C@H](C)C(=O)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C21H31NO4/c1-3-4-5-6-10-13-19(23)16(2)20(24)22-18(15-26-21(22)25)14-17-11-8-7-9-12-17/h7-9,11-12,16,18-19,23H,3-6,10,13-15H2,1-2H3/t16-,18?,19-/m0/s1 |
| InChIKey | SJQRQINJUZJIKP-NMBLWERJSA-N |
| XLogP | 3.93 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|