C19H25NO5 — CID 10991632
(2R,4S,5R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4-dimethylheptane-1,3-dione (PubChem CID 10991632) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is (2R,4S,5R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4-dimethylheptane-1,3-dione.
| Compound Name | (2R,4S,5R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4-dimethylheptane-1,3-dione |
|---|---|
| PubChem CID | 10991632 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2R,4S,5R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4-dimethylheptane-1,3-dione |
| SMILES | CC[C@@H](O)[C@H](C)C(=O)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H25NO5/c1-4-16(21)12(2)17(22)13(3)18(23)20-15(11-25-19(20)24)10-14-8-6-5-7-9-14/h5-9,12-13,15-16,21H,4,10-11H2,1-3H3/t12-,13+,15+,16+/m0/s1 |
| InChIKey | IFMJTPUVNCJSIR-SJXGUFTOSA-N |
| XLogP | 2.19 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|