C24H33NO5Si — CID 134942467
(2S,4R,5S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4-dimethyl-9-trimethylsilylnon-8-yne-1,3-dione (PubChem CID 134942467) has the molecular formula C24H33NO5Si and a molecular weight of 443.62 g/mol. Its IUPAC name is (2S,4R,5S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4-dimethyl-9-trimethylsilylnon-8-yne-1,3-dione.
| Compound Name | (2S,4R,5S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4-dimethyl-9-trimethylsilylnon-8-yne-1,3-dione |
|---|---|
| PubChem CID | 134942467 |
| Molecular Formula | C24H33NO5Si |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (2S,4R,5S)-1-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-2,4-dimethyl-9-trimethylsilylnon-8-yne-1,3-dione |
| SMILES | C[C@@H](C(=O)[C@H](C)[C@@H](O)CCC#C[Si](C)(C)C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H33NO5Si/c1-17(21(26)13-9-10-14-31(3,4)5)22(27)18(2)23(28)25-20(16-30-24(25)29)15-19-11-7-6-8-12-19/h6-8,11-12,17-18,20-21,26H,9,13,15-16H2,1-5H3/t17-,18+,20+,21+/m1/s1 |
| InChIKey | QJBZTIKPSOFKAL-ZFMNYDKASA-N |
| XLogP | 3.44 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|