C16H19NO4 — CID 123710125
(4R)-4-benzyl-3-[(E)-2-[(1S)-1-hydroxyethyl]but-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 123710125) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(E)-2-[(1S)-1-hydroxyethyl]but-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(E)-2-[(1S)-1-hydroxyethyl]but-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123710125 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (4R)-4-benzyl-3-[(E)-2-[(1S)-1-hydroxyethyl]but-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C(/C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@H](C)O |
| InChI | InChI=1S/C16H19NO4/c1-3-14(11(2)18)15(19)17-13(10-21-16(17)20)9-12-7-5-4-6-8-12/h3-8,11,13,18H,9-10H2,1-2H3/b14-3+/t11-,13+/m0/s1 |
| InChIKey | RJKOQEUUMMQXKM-WDLFDXSTSA-N |
| XLogP | 1.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|