C19H27NO4 — CID 10936532
(4R)-3-[(2R,3S)-3-hydroxy-2-methylnonanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 10936532) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (4R)-3-[(2R,3S)-3-hydroxy-2-methylnonanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2R,3S)-3-hydroxy-2-methylnonanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10936532 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (4R)-3-[(2R,3S)-3-hydroxy-2-methylnonanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCC[C@H](O)[C@@H](C)C(=O)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H27NO4/c1-3-4-5-9-12-17(21)14(2)18(22)20-16(13-24-19(20)23)15-10-7-6-8-11-15/h6-8,10-11,14,16-17,21H,3-5,9,12-13H2,1-2H3/t14-,16+,17+/m1/s1 |
| InChIKey | IDJNJSLPLKUKRI-PVAVHDDUSA-N |
| XLogP | 3.67 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|