C17H19NO3 — CID 123161521
3-(2-methylhept-4-ynoyl)-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 123161521) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 3-(2-methylhept-4-ynoyl)-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-(2-methylhept-4-ynoyl)-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 123161521 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 3-(2-methylhept-4-ynoyl)-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCC#CCC(C)C(=O)N1C(=O)OCC1c1ccccc1 |
| InChI | InChI=1S/C17H19NO3/c1-3-4-6-9-13(2)16(19)18-15(12-21-17(18)20)14-10-7-5-8-11-14/h5,7-8,10-11,13,15H,3,9,12H2,1-2H3 |
| InChIKey | JQCRBXCQAQPASK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|