C22H23NO3 — CID 126708215
(4S)-4-phenyl-3-[(2R)-2-[(1S)-1-phenylethyl]pent-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 126708215) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is (4S)-4-phenyl-3-[(2R)-2-[(1S)-1-phenylethyl]pent-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-phenyl-3-[(2R)-2-[(1S)-1-phenylethyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 126708215 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (4S)-4-phenyl-3-[(2R)-2-[(1S)-1-phenylethyl]pent-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@@H](C(=O)N1C(=O)OC[C@@H]1c1ccccc1)[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C22H23NO3/c1-3-10-19(16(2)17-11-6-4-7-12-17)21(24)23-20(15-26-22(23)25)18-13-8-5-9-14-18/h3-9,11-14,16,19-20H,1,10,15H2,2H3/t16-,19-,20-/m1/s1 |
| InChIKey | GJVOTHISNXRUSE-NSISKUIASA-N |
| XLogP | 4.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|