C20H19NO3 — CID 15314139
(4R)-4-phenyl-3-(3-phenylpent-4-enoyl)-1,3-oxazolidin-2-one (PubChem CID 15314139) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (4R)-4-phenyl-3-(3-phenylpent-4-enoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-phenyl-3-(3-phenylpent-4-enoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15314139 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (4R)-4-phenyl-3-(3-phenylpent-4-enoyl)-1,3-oxazolidin-2-one |
| SMILES | C=CC(CC(=O)N1C(=O)OC[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H19NO3/c1-2-15(16-9-5-3-6-10-16)13-19(22)21-18(14-24-20(21)23)17-11-7-4-8-12-17/h2-12,15,18H,1,13-14H2/t15?,18-/m0/s1 |
| InChIKey | XJRZDJNEVJUZAQ-PKHIMPSTSA-N |
| XLogP | 4.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|