C34H28N2O6 — CID 10482928
(2R,3R)-1,4-bis[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-2,3-diphenylbutane-1,4-dione (PubChem CID 10482928) has the molecular formula C34H28N2O6 and a molecular weight of 560.61 g/mol. Its IUPAC name is (2R,3R)-1,4-bis[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-2,3-diphenylbutane-1,4-dione.
| Compound Name | (2R,3R)-1,4-bis[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-2,3-diphenylbutane-1,4-dione |
|---|---|
| PubChem CID | 10482928 |
| Molecular Formula | C34H28N2O6 |
| Molecular Weight | 560.61 g/mol |
| Exact Mass | 560.19 |
| IUPAC Name | (2R,3R)-1,4-bis[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-2,3-diphenylbutane-1,4-dione |
| SMILES | O=C1OC[C@@H](c2ccccc2)N1C(=O)[C@@H](c1ccccc1)[C@@H](C(=O)N1C(=O)OC[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H28N2O6/c37-31(35-27(21-41-33(35)39)23-13-5-1-6-14-23)29(25-17-9-3-10-18-25)30(26-19-11-4-12-20-26)32(38)36-28(22-42-34(36)40)24-15-7-2-8-16-24/h1-20,27-30H,21-22H2/t27-,28-,29-,30-/m0/s1 |
| InChIKey | LJNPYARZPDZNTD-KRCBVYEFSA-N |
| XLogP | 5.99 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |