C18H15Br2NO4 — CID 102063279
(4R)-3-[(2R,3R)-2-bromo-3-(2-bromophenyl)-3-hydroxypropanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 102063279) has the molecular formula C18H15Br2NO4 and a molecular weight of 469.13 g/mol. Its IUPAC name is (4R)-3-[(2R,3R)-2-bromo-3-(2-bromophenyl)-3-hydroxypropanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2R,3R)-2-bromo-3-(2-bromophenyl)-3-hydroxypropanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102063279 |
| Molecular Formula | C18H15Br2NO4 |
| Molecular Weight | 469.13 g/mol |
| Exact Mass | 466.94 |
| IUPAC Name | (4R)-3-[(2R,3R)-2-bromo-3-(2-bromophenyl)-3-hydroxypropanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N1C(=O)[C@H](Br)[C@H](O)c1ccccc1Br |
| InChI | InChI=1S/C18H15Br2NO4/c19-13-9-5-4-8-12(13)16(22)15(20)17(23)21-14(10-25-18(21)24)11-6-2-1-3-7-11/h1-9,14-16,22H,10H2/t14-,15+,16+/m0/s1 |
| InChIKey | SFRTZHFECLELDO-ARFHVFGLSA-N |
| XLogP | 3.97 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.13 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|