C32H36BrNO4 — CID 102063273
(4R)-3-[(2S,3R)-2-bromo-3-hydroxy-3-[2-(8-phenyloctyl)phenyl]propanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 102063273) has the molecular formula C32H36BrNO4 and a molecular weight of 578.55 g/mol. Its IUPAC name is (4R)-3-[(2S,3R)-2-bromo-3-hydroxy-3-[2-(8-phenyloctyl)phenyl]propanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(2S,3R)-2-bromo-3-hydroxy-3-[2-(8-phenyloctyl)phenyl]propanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102063273 |
| Molecular Formula | C32H36BrNO4 |
| Molecular Weight | 578.55 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | (4R)-3-[(2S,3R)-2-bromo-3-hydroxy-3-[2-(8-phenyloctyl)phenyl]propanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N1C(=O)[C@@H](Br)[C@H](O)c1ccccc1CCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C32H36BrNO4/c33-29(31(36)34-28(23-38-32(34)37)26-20-11-6-12-21-26)30(35)27-22-14-13-19-25(27)18-10-4-2-1-3-7-15-24-16-8-5-9-17-24/h5-6,8-9,11-14,16-17,19-22,28-30,35H,1-4,7,10,15,18,23H2/t28-,29-,30+/m0/s1 |
| InChIKey | NFNTYOSNQSTGHT-OIFRRMEBSA-N |
| XLogP | 7.33 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.55 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|