C21H22BrNO4 — CID 10961002
(4S)-3-[(2S,3S)-2-bromo-3-(4-methoxy-2-methylphenyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 10961002) has the molecular formula C21H22BrNO4 and a molecular weight of 432.31 g/mol. Its IUPAC name is (4S)-3-[(2S,3S)-2-bromo-3-(4-methoxy-2-methylphenyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S,3S)-2-bromo-3-(4-methoxy-2-methylphenyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10961002 |
| Molecular Formula | C21H22BrNO4 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | (4S)-3-[(2S,3S)-2-bromo-3-(4-methoxy-2-methylphenyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | COc1ccc([C@H](C)[C@H](Br)C(=O)N2C(=O)OC[C@@H]2c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C21H22BrNO4/c1-13-11-16(26-3)9-10-17(13)14(2)19(22)20(24)23-18(12-27-21(23)25)15-7-5-4-6-8-15/h4-11,14,18-19H,12H2,1-3H3/t14-,18+,19-/m0/s1 |
| InChIKey | YPXLYMRZNMNZGG-KYNGSXCRSA-N |
| XLogP | 4.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|