C17H15NO4 — CID 134870683
(2R)-2-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylacetic acid (PubChem CID 134870683) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is (2R)-2-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylacetic acid.
| Compound Name | (2R)-2-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 134870683 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (2R)-2-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]-2-phenylacetic acid |
| SMILES | O=C(O)[C@@H](c1ccccc1)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H15NO4/c19-16(20)15(13-9-5-2-6-10-13)18-14(11-22-17(18)21)12-7-3-1-4-8-12/h1-10,14-15H,11H2,(H,19,20)/t14-,15+/m0/s1 |
| InChIKey | XJLPQCAZMULKBB-LSDHHAIUSA-N |
| XLogP | 3.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |