C14H21NO3Si — CID 134936571
(4R)-4-phenyl-3-[(1S)-1-trimethylsilyloxyethyl]-1,3-oxazolidin-2-one (PubChem CID 134936571) has the molecular formula C14H21NO3Si and a molecular weight of 279.41 g/mol. Its IUPAC name is (4R)-4-phenyl-3-[(1S)-1-trimethylsilyloxyethyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-phenyl-3-[(1S)-1-trimethylsilyloxyethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134936571 |
| Molecular Formula | C14H21NO3Si |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (4R)-4-phenyl-3-[(1S)-1-trimethylsilyloxyethyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](O[Si](C)(C)C)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H21NO3Si/c1-11(18-19(2,3)4)15-13(10-17-14(15)16)12-8-6-5-7-9-12/h5-9,11,13H,10H2,1-4H3/t11-,13-/m0/s1 |
| InChIKey | SKBLWALEAJSOHV-AAEUAGOBSA-N |
| XLogP | 3.38 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|