C25H31NO4Si — CID 11419224
(4R)-3-[(3R,4S,5S)-4-hydroxy-5-phenylmethoxy-1-trimethylsilylhex-1-yn-3-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 11419224) has the molecular formula C25H31NO4Si and a molecular weight of 437.61 g/mol. Its IUPAC name is (4R)-3-[(3R,4S,5S)-4-hydroxy-5-phenylmethoxy-1-trimethylsilylhex-1-yn-3-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(3R,4S,5S)-4-hydroxy-5-phenylmethoxy-1-trimethylsilylhex-1-yn-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11419224 |
| Molecular Formula | C25H31NO4Si |
| Molecular Weight | 437.61 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (4R)-3-[(3R,4S,5S)-4-hydroxy-5-phenylmethoxy-1-trimethylsilylhex-1-yn-3-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H](OCc1ccccc1)[C@@H](O)[C@@H](C#C[Si](C)(C)C)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H31NO4Si/c1-19(29-17-20-11-7-5-8-12-20)24(27)22(15-16-31(2,3)4)26-23(18-30-25(26)28)21-13-9-6-10-14-21/h5-14,19,22-24,27H,17-18H2,1-4H3/t19-,22+,23-,24+/m0/s1 |
| InChIKey | HTWVDPRJSKATCV-GMHONNGPSA-N |
| XLogP | 4.40 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.61 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|