C24H35NO4Si — CID 10502726
(4S)-3-[2-methyl-3-[(1R)-1-phenylmethoxyethyl]-5-trimethylsilylpent-4-ynoyl]-4-propan-2-yl-1,3-oxazolidin-2-one (PubChem CID 10502726) has the molecular formula C24H35NO4Si and a molecular weight of 429.63 g/mol. Its IUPAC name is (4S)-3-[2-methyl-3-[(1R)-1-phenylmethoxyethyl]-5-trimethylsilylpent-4-ynoyl]-4-propan-2-yl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[2-methyl-3-[(1R)-1-phenylmethoxyethyl]-5-trimethylsilylpent-4-ynoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10502726 |
| Molecular Formula | C24H35NO4Si |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (4S)-3-[2-methyl-3-[(1R)-1-phenylmethoxyethyl]-5-trimethylsilylpent-4-ynoyl]-4-propan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CC(C(=O)N1C(=O)OC[C@@H]1C(C)C)C(C#C[Si](C)(C)C)[C@@H](C)OCc1ccccc1 |
| InChI | InChI=1S/C24H35NO4Si/c1-17(2)22-16-29-24(27)25(22)23(26)18(3)21(13-14-30(5,6)7)19(4)28-15-20-11-9-8-10-12-20/h8-12,17-19,21-22H,15-16H2,1-7H3/t18?,19-,21?,22-/m1/s1 |
| InChIKey | XULZQDGALAJXGT-XZJNEJNUSA-N |
| XLogP | 4.73 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|