C25H31NO5Se — CID 101004748
(2R,3S)-3-hydroxy-2,4-bis(phenylmethoxy)-1-[(4S)-4-propan-2-yl-2-selanylidene-1,3-oxazolidin-3-yl]pentan-1-one (PubChem CID 101004748) has the molecular formula C25H31NO5Se and a molecular weight of 504.49 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2,4-bis(phenylmethoxy)-1-[(4S)-4-propan-2-yl-2-selanylidene-1,3-oxazolidin-3-yl]pentan-1-one.
| Compound Name | (2R,3S)-3-hydroxy-2,4-bis(phenylmethoxy)-1-[(4S)-4-propan-2-yl-2-selanylidene-1,3-oxazolidin-3-yl]pentan-1-one |
|---|---|
| PubChem CID | 101004748 |
| Molecular Formula | C25H31NO5Se |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | (2R,3S)-3-hydroxy-2,4-bis(phenylmethoxy)-1-[(4S)-4-propan-2-yl-2-selanylidene-1,3-oxazolidin-3-yl]pentan-1-one |
| SMILES | CC(C)[C@H]1COC(=[Se])N1C(=O)[C@H](OCc1ccccc1)[C@@H](O)C(C)OCc1ccccc1 |
| InChI | InChI=1S/C25H31NO5Se/c1-17(2)21-16-31-25(32)26(21)24(28)23(30-15-20-12-8-5-9-13-20)22(27)18(3)29-14-19-10-6-4-7-11-19/h4-13,17-18,21-23,27H,14-16H2,1-3H3/t18?,21-,22+,23-/m1/s1 |
| InChIKey | WBNCYKDENZWLKS-HMHBSYAJSA-N |
| XLogP | 2.68 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|