C22H25NO4Se — CID 59910073
(2R,3R)-1-[(4S)-4-benzyl-2-selanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-methyl-4-phenylmethoxybutan-1-one (PubChem CID 59910073) has the molecular formula C22H25NO4Se and a molecular weight of 446.41 g/mol. Its IUPAC name is (2R,3R)-1-[(4S)-4-benzyl-2-selanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-methyl-4-phenylmethoxybutan-1-one.
| Compound Name | (2R,3R)-1-[(4S)-4-benzyl-2-selanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-methyl-4-phenylmethoxybutan-1-one |
|---|---|
| PubChem CID | 59910073 |
| Molecular Formula | C22H25NO4Se |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | (2R,3R)-1-[(4S)-4-benzyl-2-selanylidene-1,3-oxazolidin-3-yl]-3-hydroxy-2-methyl-4-phenylmethoxybutan-1-one |
| SMILES | C[C@@H](C(=O)N1C(=[Se])OC[C@@H]1Cc1ccccc1)[C@@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C22H25NO4Se/c1-16(20(24)15-26-13-18-10-6-3-7-11-18)21(25)23-19(14-27-22(23)28)12-17-8-4-2-5-9-17/h2-11,16,19-20,24H,12-15H2,1H3/t16-,19+,20+/m1/s1 |
| InChIKey | PDOYZNJBYZZYOE-UXPWSPDFSA-N |
| XLogP | 1.93 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|