C19H27NO4Se — CID 101004742
(2R,3S)-1-[(4S)-4-benzyl-2-selanylidene-1,3-oxazolidin-3-yl]-4-butoxy-3-hydroxy-2-methylbutan-1-one (PubChem CID 101004742) has the molecular formula C19H27NO4Se and a molecular weight of 412.39 g/mol. Its IUPAC name is (2R,3S)-1-[(4S)-4-benzyl-2-selanylidene-1,3-oxazolidin-3-yl]-4-butoxy-3-hydroxy-2-methylbutan-1-one.
| Compound Name | (2R,3S)-1-[(4S)-4-benzyl-2-selanylidene-1,3-oxazolidin-3-yl]-4-butoxy-3-hydroxy-2-methylbutan-1-one |
|---|---|
| PubChem CID | 101004742 |
| Molecular Formula | C19H27NO4Se |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | (2R,3S)-1-[(4S)-4-benzyl-2-selanylidene-1,3-oxazolidin-3-yl]-4-butoxy-3-hydroxy-2-methylbutan-1-one |
| SMILES | CCCCOC[C@@H](O)[C@@H](C)C(=O)N1C(=[Se])OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C19H27NO4Se/c1-3-4-10-23-13-17(21)14(2)18(22)20-16(12-24-19(20)25)11-15-8-6-5-7-9-15/h5-9,14,16-17,21H,3-4,10-13H2,1-2H3/t14-,16+,17-/m1/s1 |
| InChIKey | YSWIDSWUFJUYCF-HYVNUMGLSA-N |
| XLogP | 1.53 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|