C23H27NO5 — CID 102386100
(4S)-3-[(2S,3R)-3-hydroxy-2-methyl-6-phenylmethoxyhexanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 102386100) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is (4S)-3-[(2S,3R)-3-hydroxy-2-methyl-6-phenylmethoxyhexanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2S,3R)-3-hydroxy-2-methyl-6-phenylmethoxyhexanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102386100 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (4S)-3-[(2S,3R)-3-hydroxy-2-methyl-6-phenylmethoxyhexanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@H](C(=O)N1C(=O)OC[C@@H]1c1ccccc1)[C@H](O)CCCOCc1ccccc1 |
| InChI | InChI=1S/C23H27NO5/c1-17(21(25)13-8-14-28-15-18-9-4-2-5-10-18)22(26)24-20(16-29-23(24)27)19-11-6-3-7-12-19/h2-7,9-12,17,20-21,25H,8,13-16H2,1H3/t17-,20+,21+/m0/s1 |
| InChIKey | IJEIJVJNHDVDIJ-IOMROCGXSA-N |
| XLogP | 3.70 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|