C26H33NO4 — CID 11384699
(4S)-4-phenyl-3-[(2R,3S,5S)-2,3,5-trimethyl-7-phenylmethoxyheptanoyl]-1,3-oxazolidin-2-one (PubChem CID 11384699) has the molecular formula C26H33NO4 and a molecular weight of 423.55 g/mol. Its IUPAC name is (4S)-4-phenyl-3-[(2R,3S,5S)-2,3,5-trimethyl-7-phenylmethoxyheptanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-phenyl-3-[(2R,3S,5S)-2,3,5-trimethyl-7-phenylmethoxyheptanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11384699 |
| Molecular Formula | C26H33NO4 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | (4S)-4-phenyl-3-[(2R,3S,5S)-2,3,5-trimethyl-7-phenylmethoxyheptanoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@H](CCOCc1ccccc1)C[C@H](C)[C@@H](C)C(=O)N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H33NO4/c1-19(14-15-30-17-22-10-6-4-7-11-22)16-20(2)21(3)25(28)27-24(18-31-26(27)29)23-12-8-5-9-13-23/h4-13,19-21,24H,14-18H2,1-3H3/t19-,20+,21-,24-/m1/s1 |
| InChIKey | ZTBXCXRQVWVCHL-OOICKAIWSA-N |
| XLogP | 5.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|