C21H21NO4 — CID 25231256
(4S)-3-[(E)-2-methyl-4-phenylmethoxybut-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 25231256) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is (4S)-3-[(E)-2-methyl-4-phenylmethoxybut-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(E)-2-methyl-4-phenylmethoxybut-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 25231256 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | (4S)-3-[(E)-2-methyl-4-phenylmethoxybut-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C/C(=C\COCc1ccccc1)C(=O)N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H21NO4/c1-16(12-13-25-14-17-8-4-2-5-9-17)20(23)22-19(15-26-21(22)24)18-10-6-3-7-11-18/h2-12,19H,13-15H2,1H3/b16-12+/t19-/m1/s1 |
| InChIKey | AFXKALDYCQGQCA-APEZIOSESA-N |
| XLogP | 3.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|