C17H17NO7 — CID 25140666
methyl (E)-4-[2,3-dioxo-3-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]propoxy]but-2-enoate (PubChem CID 25140666) has the molecular formula C17H17NO7 and a molecular weight of 347.32 g/mol. Its IUPAC name is methyl (E)-4-[2,3-dioxo-3-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]propoxy]but-2-enoate.
| Compound Name | methyl (E)-4-[2,3-dioxo-3-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]propoxy]but-2-enoate |
|---|---|
| PubChem CID | 25140666 |
| Molecular Formula | C17H17NO7 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | methyl (E)-4-[2,3-dioxo-3-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]propoxy]but-2-enoate |
| SMILES | COC(=O)/C=C/COCC(=O)C(=O)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17NO7/c1-23-15(20)8-5-9-24-11-14(19)16(21)18-13(10-25-17(18)22)12-6-3-2-4-7-12/h2-8,13H,9-11H2,1H3/b8-5+/t13-/m0/s1 |
| InChIKey | HLSVKMKJXJTGGI-LJLILKBBSA-N |
| XLogP | 1.02 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|