C15H15NO3 — CID 10848742
(4R)-3-[(E)-3-cyclopropylprop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 10848742) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is (4R)-3-[(E)-3-cyclopropylprop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(E)-3-cyclopropylprop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10848742 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (4R)-3-[(E)-3-cyclopropylprop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C/C1CC1)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H15NO3/c17-14(9-8-11-6-7-11)16-13(10-19-15(16)18)12-4-2-1-3-5-12/h1-5,8-9,11,13H,6-7,10H2/b9-8+/t13-/m0/s1 |
| InChIKey | ZRLNINBSUNBMPU-XEHSLEBBSA-N |
| XLogP | 2.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|