C18H14INO3 — CID 167227898
(4R)-3-[(E)-3-(3-iodophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 167227898) has the molecular formula C18H14INO3 and a molecular weight of 419.22 g/mol. Its IUPAC name is (4R)-3-[(E)-3-(3-iodophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[(E)-3-(3-iodophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 167227898 |
| Molecular Formula | C18H14INO3 |
| Molecular Weight | 419.22 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | (4R)-3-[(E)-3-(3-iodophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C/c1cccc(I)c1)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H14INO3/c19-15-8-4-5-13(11-15)9-10-17(21)20-16(12-23-18(20)22)14-6-2-1-3-7-14/h1-11,16H,12H2/b10-9+/t16-/m0/s1 |
| InChIKey | HIOHHMIWFSSOKQ-SCOAYWHSSA-N |
| XLogP | 4.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.22 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|