C21H15ClN2O3 — CID 170696049
(4S)-3-[(E)-3-(2-chloroquinolin-4-yl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 170696049) has the molecular formula C21H15ClN2O3 and a molecular weight of 378.82 g/mol. Its IUPAC name is (4S)-3-[(E)-3-(2-chloroquinolin-4-yl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(E)-3-(2-chloroquinolin-4-yl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 170696049 |
| Molecular Formula | C21H15ClN2O3 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (4S)-3-[(E)-3-(2-chloroquinolin-4-yl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C(/C=C/c1cc(Cl)nc2ccccc12)N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H15ClN2O3/c22-19-12-15(16-8-4-5-9-17(16)23-19)10-11-20(25)24-18(13-27-21(24)26)14-6-2-1-3-7-14/h1-12,18H,13H2/b11-10+/t18-/m1/s1 |
| InChIKey | VPOJAOHLENLTGF-DOJUMQAQSA-N |
| XLogP | 4.62 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|