About 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane
3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane (PubChem CID 144871050) has the molecular formula C20H19F2NO3
and a molecular weight of 359.37 g/mol. Its IUPAC name is 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane.
Molecular Properties
| Compound Name | 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane |
| PubChem CID | 144871050 |
| Molecular Formula | C20H19F2NO3 |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane |
| SMILES | CC.O=C(/C=C/c1cc(F)cc(F)c1)N1C(=O)OCC1c1ccccc1 |
| InChI | InChI=1S/C18H13F2NO3.C2H6/c19-14-8-12(9-15(20)10-14)6-7-17(22)21-16(11-24-18(21)23)13-4-2-1-3-5-13;1-2/h1-10,16H,11H2;1-2H3/b7-6+; |
| InChIKey | GKRSLXQZZZSTCC-UHDJGPCESA-N |
| XLogP | 4.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane?
The IUPAC name of 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane (CID 144871050) is 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane.
What is the SMILES notation for 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane?
The canonical SMILES for 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane is CC.O=C(/C=C/c1cc(F)cc(F)c1)N1C(=O)OCC1c1ccccc1.
What is the InChIKey of 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane?
The InChIKey is GKRSLXQZZZSTCC-UHDJGPCESA-N. The full InChI is InChI=1S/C18H13F2NO3.C2H6/c19-14-8-12(9-15(20)10-14)6-7-17(22)21-16(11-24-18(21)23)13-4-2-1-3-5-13;1-2/h1-10,16H,11H2;1-2H3/b7-6+;.
What are the key properties of 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane?
3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane has a molecular weight of 359.37 g/mol, XLogP of 4.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-3-(3,5-difluorophenyl)prop-2-enoyl]-4-phenyl-1,3-oxazolidin-2-one;ethane is sourced from PubChem (CID 144871050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).