C16H15NO4 — CID 139254687
methyl (E)-6-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]hex-2-en-5-ynoate (PubChem CID 139254687) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is methyl (E)-6-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]hex-2-en-5-ynoate.
| Compound Name | methyl (E)-6-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]hex-2-en-5-ynoate |
|---|---|
| PubChem CID | 139254687 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | methyl (E)-6-[(4R)-2-oxo-4-phenyl-1,3-oxazolidin-3-yl]hex-2-en-5-ynoate |
| SMILES | COC(=O)/C=C/CC#CN1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H15NO4/c1-20-15(18)10-6-3-7-11-17-14(12-21-16(17)19)13-8-4-2-5-9-13/h2,4-6,8-10,14H,3,12H2,1H3/b10-6+/t14-/m0/s1 |
| InChIKey | BCJHFSBARXJMEX-XYYIANASSA-N |
| XLogP | 2.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|