C15H19NO2Se — CID 10448903
2-phenyl-1-[(4S)-4-propyl-2-selanylidene-1,3-oxazolidin-3-yl]propan-1-one (PubChem CID 10448903) has the molecular formula C15H19NO2Se and a molecular weight of 324.28 g/mol. Its IUPAC name is 2-phenyl-1-[(4S)-4-propyl-2-selanylidene-1,3-oxazolidin-3-yl]propan-1-one.
| Compound Name | 2-phenyl-1-[(4S)-4-propyl-2-selanylidene-1,3-oxazolidin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 10448903 |
| Molecular Formula | C15H19NO2Se |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-phenyl-1-[(4S)-4-propyl-2-selanylidene-1,3-oxazolidin-3-yl]propan-1-one |
| SMILES | CCC[C@H]1COC(=[Se])N1C(=O)C(C)c1ccccc1 |
| InChI | InChI=1S/C15H19NO2Se/c1-3-7-13-10-18-15(19)16(13)14(17)11(2)12-8-5-4-6-9-12/h4-6,8-9,11,13H,3,7,10H2,1-2H3/t11?,13-/m0/s1 |
| InChIKey | BFZILTLGEJYGPB-YUZLPWPTSA-N |
| XLogP | 2.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|