C21H23NO2 — CID 11809413
(4R)-4-phenyl-3-[(3S)-1-phenylhex-5-en-3-yl]-1,3-oxazolidin-2-one (PubChem CID 11809413) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (4R)-4-phenyl-3-[(3S)-1-phenylhex-5-en-3-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-phenyl-3-[(3S)-1-phenylhex-5-en-3-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11809413 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (4R)-4-phenyl-3-[(3S)-1-phenylhex-5-en-3-yl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H](CCc1ccccc1)N1C(=O)OC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-2-9-19(15-14-17-10-5-3-6-11-17)22-20(16-24-21(22)23)18-12-7-4-8-13-18/h2-8,10-13,19-20H,1,9,14-16H2/t19-,20+/m1/s1 |
| InChIKey | NOGGEPJUJUXRGR-UXHICEINSA-N |
| XLogP | 4.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|