C17H15NO3 — CID 102344135
(5S,10bR)-10-hydroxy-5-phenyl-1,5,6,10b-tetrahydro-[1,3]oxazolo[4,3-a]isoquinolin-3-one (PubChem CID 102344135) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is (5S,10bR)-10-hydroxy-5-phenyl-1,5,6,10b-tetrahydro-[1,3]oxazolo[4,3-a]isoquinolin-3-one.
| Compound Name | (5S,10bR)-10-hydroxy-5-phenyl-1,5,6,10b-tetrahydro-[1,3]oxazolo[4,3-a]isoquinolin-3-one |
|---|---|
| PubChem CID | 102344135 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | (5S,10bR)-10-hydroxy-5-phenyl-1,5,6,10b-tetrahydro-[1,3]oxazolo[4,3-a]isoquinolin-3-one |
| SMILES | O=C1OC[C@H]2c3c(O)cccc3C[C@@H](c3ccccc3)N12 |
| InChI | InChI=1S/C17H15NO3/c19-15-8-4-7-12-9-13(11-5-2-1-3-6-11)18-14(16(12)15)10-21-17(18)20/h1-8,13-14,19H,9-10H2/t13-,14-/m0/s1 |
| InChIKey | OMPSNWARSHUCDO-KBPBESRZSA-N |
| XLogP | 3.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|