C16H22N2O2 — CID 143706107
(4S)-3-[4-(aminomethyl)cyclohexyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 143706107) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (4S)-3-[4-(aminomethyl)cyclohexyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[4-(aminomethyl)cyclohexyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 143706107 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (4S)-3-[4-(aminomethyl)cyclohexyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | NCC1CCC(N2C(=O)OC[C@@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C16H22N2O2/c17-10-12-6-8-14(9-7-12)18-15(11-20-16(18)19)13-4-2-1-3-5-13/h1-5,12,14-15H,6-11,17H2/t12?,14?,15-/m1/s1 |
| InChIKey | WMFBFQYUBWUMSQ-PESDSKBTSA-N |
| XLogP | 2.70 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |