C23H25N3O4S — CID 3687517
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbothioamide (PubChem CID 3687517) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbothioamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3687517 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbothioamide |
| SMILES | O=C1OCC(c2ccccc2)N1C1CCN(C(=S)Nc2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C23H25N3O4S/c27-23-26(19(15-30-23)16-4-2-1-3-5-16)18-8-10-25(11-9-18)22(31)24-17-6-7-20-21(14-17)29-13-12-28-20/h1-7,14,18-19H,8-13,15H2,(H,24,31) |
| InChIKey | UWRABJFKNFJPIH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|