C25H27N3O7 — CID 3869172
dimethyl 5-[[4-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]benzene-1,3-dicarboxylate (PubChem CID 3869172) has the molecular formula C25H27N3O7 and a molecular weight of 481.51 g/mol. Its IUPAC name is dimethyl 5-[[4-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[4-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 3869172 |
| Molecular Formula | C25H27N3O7 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | dimethyl 5-[[4-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)piperidine-1-carbonyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)N2CCC(N3C(=O)OCC3c3ccccc3)CC2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C25H27N3O7/c1-33-22(29)17-12-18(23(30)34-2)14-19(13-17)26-24(31)27-10-8-20(9-11-27)28-21(15-35-25(28)32)16-6-4-3-5-7-16/h3-7,12-14,20-21H,8-11,15H2,1-2H3,(H,26,31) |
| InChIKey | HYMZIRSHEIWRRV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|