C22H22F3N3O2S — CID 3486012
4-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carbothioamide (PubChem CID 3486012) has the molecular formula C22H22F3N3O2S and a molecular weight of 449.50 g/mol. Its IUPAC name is 4-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carbothioamide.
| Compound Name | 4-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3486012 |
| Molecular Formula | C22H22F3N3O2S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 4-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)-N-[2-(trifluoromethyl)phenyl]piperidine-1-carbothioamide |
| SMILES | O=C1OCC(c2ccccc2)N1C1CCN(C(=S)Nc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H22F3N3O2S/c23-22(24,25)17-8-4-5-9-18(17)26-20(31)27-12-10-16(11-13-27)28-19(14-30-21(28)29)15-6-2-1-3-7-15/h1-9,16,19H,10-14H2,(H,26,31) |
| InChIKey | XHCYBRDOLRYVEE-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|