C22H25F3N4OS — CID 74226111
N-benzyl-2-[4-[[2-(trifluoromethyl)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetamide (PubChem CID 74226111) has the molecular formula C22H25F3N4OS and a molecular weight of 450.53 g/mol. Its IUPAC name is N-benzyl-2-[4-[[2-(trifluoromethyl)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetamide.
| Compound Name | N-benzyl-2-[4-[[2-(trifluoromethyl)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetamide |
|---|---|
| PubChem CID | 74226111 |
| Molecular Formula | C22H25F3N4OS |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-benzyl-2-[4-[[2-(trifluoromethyl)phenyl]carbamothioyl]-1,4-diazepan-1-yl]acetamide |
| SMILES | O=C(CN1CCCN(C(=S)Nc2ccccc2C(F)(F)F)CC1)NCc1ccccc1 |
| InChI | InChI=1S/C22H25F3N4OS/c23-22(24,25)18-9-4-5-10-19(18)27-21(31)29-12-6-11-28(13-14-29)16-20(30)26-15-17-7-2-1-3-8-17/h1-5,7-10H,6,11-16H2,(H,26,30)(H,27,31) |
| InChIKey | ZELRBDNXNNTAJD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|