C21H23F3N4O2 — CID 3800290
4-[2-(benzylamino)-2-oxoethyl]-N-(2,3,4-trifluorophenyl)-1,4-diazepane-1-carboxamide (PubChem CID 3800290) has the molecular formula C21H23F3N4O2 and a molecular weight of 420.44 g/mol. Its IUPAC name is 4-[2-(benzylamino)-2-oxoethyl]-N-(2,3,4-trifluorophenyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-[2-(benzylamino)-2-oxoethyl]-N-(2,3,4-trifluorophenyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 3800290 |
| Molecular Formula | C21H23F3N4O2 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 4-[2-(benzylamino)-2-oxoethyl]-N-(2,3,4-trifluorophenyl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(CN1CCCN(C(=O)Nc2ccc(F)c(F)c2F)CC1)NCc1ccccc1 |
| InChI | InChI=1S/C21H23F3N4O2/c22-16-7-8-17(20(24)19(16)23)26-21(30)28-10-4-9-27(11-12-28)14-18(29)25-13-15-5-2-1-3-6-15/h1-3,5-8H,4,9-14H2,(H,25,29)(H,26,30) |
| InChIKey | XURGUHRJFSOQQB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|