C19H19ClF3N3O — CID 113110975
4-[2-(3-chlorophenyl)ethyl]-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide (PubChem CID 113110975) has the molecular formula C19H19ClF3N3O and a molecular weight of 397.83 g/mol. Its IUPAC name is 4-[2-(3-chlorophenyl)ethyl]-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-(3-chlorophenyl)ethyl]-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113110975 |
| Molecular Formula | C19H19ClF3N3O |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-[2-(3-chlorophenyl)ethyl]-N-(2,3,4-trifluorophenyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)N1CCN(CCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H19ClF3N3O/c20-14-3-1-2-13(12-14)6-7-25-8-10-26(11-9-25)19(27)24-16-5-4-15(21)17(22)18(16)23/h1-5,12H,6-11H2,(H,24,27) |
| InChIKey | LULHVGCSUYLOFL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|