C20H22ClFN2O — CID 113075178
1-[4-[2-(3-chlorophenyl)ethyl]piperazin-1-yl]-2-(2-fluorophenyl)ethanone (PubChem CID 113075178) has the molecular formula C20H22ClFN2O and a molecular weight of 360.86 g/mol. Its IUPAC name is 1-[4-[2-(3-chlorophenyl)ethyl]piperazin-1-yl]-2-(2-fluorophenyl)ethanone.
| Compound Name | 1-[4-[2-(3-chlorophenyl)ethyl]piperazin-1-yl]-2-(2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 113075178 |
| Molecular Formula | C20H22ClFN2O |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1-[4-[2-(3-chlorophenyl)ethyl]piperazin-1-yl]-2-(2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1F)N1CCN(CCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H22ClFN2O/c21-18-6-3-4-16(14-18)8-9-23-10-12-24(13-11-23)20(25)15-17-5-1-2-7-19(17)22/h1-7,14H,8-13,15H2 |
| InChIKey | DDZQHQSEHHZKSE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |