C21H25ClN2O — CID 113075180
1-[4-[2-(3-chlorophenyl)ethyl]piperazin-1-yl]-2-(2-methylphenyl)ethanone (PubChem CID 113075180) has the molecular formula C21H25ClN2O and a molecular weight of 356.90 g/mol. Its IUPAC name is 1-[4-[2-(3-chlorophenyl)ethyl]piperazin-1-yl]-2-(2-methylphenyl)ethanone.
| Compound Name | 1-[4-[2-(3-chlorophenyl)ethyl]piperazin-1-yl]-2-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 113075180 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-[4-[2-(3-chlorophenyl)ethyl]piperazin-1-yl]-2-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1CC(=O)N1CCN(CCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C21H25ClN2O/c1-17-5-2-3-7-19(17)16-21(25)24-13-11-23(12-14-24)10-9-18-6-4-8-20(22)15-18/h2-8,15H,9-14,16H2,1H3 |
| InChIKey | FSJKPPOROBRNQY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |