C17H26ClN3O — CID 110608445
4-[2-(3-chlorophenyl)ethyl]-N-(2-methylpropyl)piperazine-1-carboxamide (PubChem CID 110608445) has the molecular formula C17H26ClN3O and a molecular weight of 323.87 g/mol. Its IUPAC name is 4-[2-(3-chlorophenyl)ethyl]-N-(2-methylpropyl)piperazine-1-carboxamide.
| Compound Name | 4-[2-(3-chlorophenyl)ethyl]-N-(2-methylpropyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 110608445 |
| Molecular Formula | C17H26ClN3O |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 4-[2-(3-chlorophenyl)ethyl]-N-(2-methylpropyl)piperazine-1-carboxamide |
| SMILES | CC(C)CNC(=O)N1CCN(CCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H26ClN3O/c1-14(2)13-19-17(22)21-10-8-20(9-11-21)7-6-15-4-3-5-16(18)12-15/h3-5,12,14H,6-11,13H2,1-2H3,(H,19,22) |
| InChIKey | RAMVDEKVEDTAJW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |