C18H28ClN3O — CID 95331476
3-(3-chlorophenyl)-N-[(2S)-2-methyl-3-(4-methylpiperazin-1-yl)propyl]propanamide (PubChem CID 95331476) has the molecular formula C18H28ClN3O and a molecular weight of 337.90 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-[(2S)-2-methyl-3-(4-methylpiperazin-1-yl)propyl]propanamide.
| Compound Name | 3-(3-chlorophenyl)-N-[(2S)-2-methyl-3-(4-methylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 95331476 |
| Molecular Formula | C18H28ClN3O |
| Molecular Weight | 337.90 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 3-(3-chlorophenyl)-N-[(2S)-2-methyl-3-(4-methylpiperazin-1-yl)propyl]propanamide |
| SMILES | C[C@@H](CNC(=O)CCc1cccc(Cl)c1)CN1CCN(C)CC1 |
| InChI | InChI=1S/C18H28ClN3O/c1-15(14-22-10-8-21(2)9-11-22)13-20-18(23)7-6-16-4-3-5-17(19)12-16/h3-5,12,15H,6-11,13-14H2,1-2H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | UVDZYENSZCOHEC-HNNXBMFYSA-N |
| XLogP | 2.27 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.90 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |