C18H30N4O3 — CID 86823630
N-[4-[[2-methyl-3-(4-methylpiperazin-1-yl)propyl]amino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 86823630) has the molecular formula C18H30N4O3 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-[4-[[2-methyl-3-(4-methylpiperazin-1-yl)propyl]amino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[[2-methyl-3-(4-methylpiperazin-1-yl)propyl]amino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86823630 |
| Molecular Formula | C18H30N4O3 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | N-[4-[[2-methyl-3-(4-methylpiperazin-1-yl)propyl]amino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | CC(CNC(=O)CCCNC(=O)c1ccco1)CN1CCN(C)CC1 |
| InChI | InChI=1S/C18H30N4O3/c1-15(14-22-10-8-21(2)9-11-22)13-20-17(23)6-3-7-19-18(24)16-5-4-12-25-16/h4-5,12,15H,3,6-11,13-14H2,1-2H3,(H,19,24)(H,20,23) |
| InChIKey | HNYFRHUAUZFHBM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|