C20H34N6O2 — CID 111167067
4-(furan-2-carbonyl)-N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111167067) has the molecular formula C20H34N6O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is 4-(furan-2-carbonyl)-N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(furan-2-carbonyl)-N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111167067 |
| Molecular Formula | C20H34N6O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | 4-(furan-2-carbonyl)-N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)CN1CCN(C)CC1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C20H34N6O2/c1-17(16-24-8-6-23(3)7-9-24)15-22-20(21-2)26-12-10-25(11-13-26)19(27)18-5-4-14-28-18/h4-5,14,17H,6-13,15-16H2,1-3H3,(H,21,22) |
| InChIKey | OEPQHFROJDRYAK-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 67.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|