C21H36N6 — CID 110961989
N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-4-phenylpiperazine-1-carboximidamide (PubChem CID 110961989) has the molecular formula C21H36N6 and a molecular weight of 372.56 g/mol. Its IUPAC name is N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-4-phenylpiperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-4-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110961989 |
| Molecular Formula | C21H36N6 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.30 |
| IUPAC Name | N'-methyl-N-[2-methyl-3-(4-methylpiperazin-1-yl)propyl]-4-phenylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(C)CN1CCN(C)CC1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H36N6/c1-19(18-25-11-9-24(3)10-12-25)17-23-21(22-2)27-15-13-26(14-16-27)20-7-5-4-6-8-20/h4-8,19H,9-18H2,1-3H3,(H,22,23) |
| InChIKey | XRACCKFNENSPKJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 37.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|