C24H42N6 — CID 111238333
4-(2,3-dimethylphenyl)-N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111238333) has the molecular formula C24H42N6 and a molecular weight of 414.64 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(2,3-dimethylphenyl)-N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111238333 |
| Molecular Formula | C24H42N6 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCN1CCN(CC(C)CN/C(=N\C)N2CCN(c3cccc(C)c3C)CC2)CC1 |
| InChI | InChI=1S/C24H42N6/c1-6-27-10-12-28(13-11-27)19-20(2)18-26-24(25-5)30-16-14-29(15-17-30)23-9-7-8-21(3)22(23)4/h7-9,20H,6,10-19H2,1-5H3,(H,25,26) |
| InChIKey | BKPNQPUTIUARFQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 37.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|