C23H40N6 — CID 111238091
4-(2,3-dimethylphenyl)-N'-methyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]piperazine-1-carboximidamide (PubChem CID 111238091) has the molecular formula C23H40N6 and a molecular weight of 400.62 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N'-methyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]piperazine-1-carboximidamide.
| Compound Name | 4-(2,3-dimethylphenyl)-N'-methyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111238091 |
| Molecular Formula | C23H40N6 |
| Molecular Weight | 400.62 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N'-methyl-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(/NCCCN1CCCN(C)CC1)N1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C23H40N6/c1-20-8-5-9-22(21(20)2)28-16-18-29(19-17-28)23(24-3)25-10-6-12-27-13-7-11-26(4)14-15-27/h5,8-9H,6-7,10-19H2,1-4H3,(H,24,25) |
| InChIKey | HIBZAMKGPSIRMJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 37.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.62 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|